For research use only. Not for therapeutic Use.
(1R)-6-Methoxy-1,2,3,4-tetrahydronaphthalen-1-amine(Cat No.:L018045)is a chiral amine compound used in pharmaceutical research, particularly in the synthesis of bioactive molecules and drug candidates. This compound features a tetrahydronaphthalene ring with a methoxy group at the 6-position and an amine group at the 1-position, with the (1R) stereochemistry providing specific biological activity. It serves as a key intermediate in developing various therapeutic agents, especially those targeting neurological and psychiatric disorders. Its high purity and defined stereochemistry are crucial for producing effective and selective medications.
CAS Number | 314019-10-8 |
Molecular Formula | C11H15NO |
Purity | ≥95% |
IUPAC Name | (1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
InChI | InChI=1S/C11H15NO/c1-13-9-5-6-10-8(7-9)3-2-4-11(10)12/h5-7,11H,2-4,12H2,1H3/t11-/m1/s1 |
InChIKey | NWDPZDVSZWOAFS-LLVKDONJSA-N |
SMILES | COC1=CC2=C(C=C1)C(CCC2)N |