(1R,2R)-1-Amino-1-phenylpropan-2-ol hydrochloride(Cat No.:L017382)is a chiral amino alcohol presented as a hydrochloride salt to enhance its solubility and stability. This enantiomerically pure compound features a phenyl group and an amino group, making it a valuable chiral building block in organic synthesis, particularly in the pharmaceutical industry. It is commonly used in the asymmetric synthesis of active pharmaceutical ingredients (APIs) that require precise stereochemical configurations for effective drug action. Its structure allows for the creation of compounds with potential activity in central nervous system disorders and other therapeutic areas requiring targeted molecular interactions.
Catalog Number | L017382 |
CAS Number | 255060-27-6 |
Molecular Formula | C9H14ClNO |
Purity | ≥95% |
IUPAC Name | (1R,2R)-1-amino-1-phenylpropan-2-ol;hydrochloride |
InChI | InChI=1S/C9H13NO.ClH/c1-7(11)9(10)8-5-3-2-4-6-8;/h2-7,9,11H,10H2,1H3;1H/t7-,9+;/m1./s1 |
InChIKey | VIOJYFJDMKDXOT-JXLXBRSFSA-N |
SMILES | CC(C(C1=CC=CC=C1)N)O.Cl |