For research use only. Not for therapeutic Use.
(1R,2R)-2-Amino-1-methylcyclopentan-1-ol(CAT: L000569) is a compound of significant importance in the fields of organic chemistry and pharmaceutical research. This chiral compound serves as a crucial building block for the synthesis of various organic molecules, particularly in the development of pharmaceuticals and bioactive compounds. Its unique structure, with a cyclopentan-1-ol and an amino group, offers opportunities for stereochemical control and structural modification, making it essential in drug development and asymmetric synthesis.
CAS Number | 1400689-45-3 |
Molecular Formula | C6H13NO |
Purity | ≥95% |
IUPAC Name | (1R,2R)-2-amino-1-methylcyclopentan-1-ol |
InChI | InChI=1S/C6H13NO/c1-6(8)4-2-3-5(6)7/h5,8H,2-4,7H2,1H3/t5-,6-/m1/s1 |
InChIKey | KKBCPZUWBKCECT-PHDIDXHHSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |