For research use only. Not for therapeutic Use.
(1R,2R)-Dimethyl cyclohexane-1,2-dicarboxylate(Cat No.:L033797)is a chiral diester widely utilized in asymmetric synthesis and pharmaceutical research. This compound, featuring two methyl ester groups on a cyclohexane ring, is particularly valuable for the production of enantiomerically pure substances. Its stereochemistry plays a crucial role in the creation of complex molecular architectures, making it an essential intermediate in the development of new drugs and fine chemicals. With its high enantiomeric purity, this diester supports advanced applications in medicinal chemistry and chiral synthesis.
CAS Number | 3205-35-4 |
Molecular Formula | C10H16O4 |
Purity | ≥95% |
IUPAC Name | dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate |
InChI | InChI=1S/C10H16O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
InChIKey | AIACXWOETVLBIA-HTQZYQBOSA-N |
SMILES | COC(=O)C1CCCCC1C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |