For research use only. Not for therapeutic Use.
(1R,2R)-N1,N2-Dibenzyl-1,2-diphenylethane-1,2-diamine (Cat.No:L003621) is a vital chemical compound with significant applications in pharmaceutical research. Its chiral, multi-substituted structure lends itself to the development of specialized ligands, particularly in asymmetric synthesis and catalysis. This compound’s unique stereochemistry makes it an invaluable tool in the creation of enantiopure compounds, underscoring its importance in contemporary medicinal and synthetic chemistry endeavors.
CAS Number | 221226-19-3 |
Molecular Formula | C28H28N2 |
Purity | ≥95% |
IUPAC Name | (1R,2R)-N,N'-dibenzyl-1,2-diphenylethane-1,2-diamine |
InChI | InChI=1S/C28H28N2/c1-5-13-23(14-6-1)21-29-27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)30-22-24-15-7-2-8-16-24/h1-20,27-30H,21-22H2/t27-,28-/m1/s1 |
InChIKey | QEUWNGJNPLRKLR-VSGBNLITSA-N |
SMILES | C1=CC=C(C=C1)CN[C@H](C2=CC=CC=C2)[C@@H](C3=CC=CC=C3)NCC4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |