For research use only. Not for therapeutic Use.
(1S)-1-(4-ethylphenyl)ethan-1-amine hydrochloride (Cat.No:L004034) is a significant compound in pharmaceutical research. Its chiral structure, incorporating an ethylphenylamine moiety, holds promise for drug development. This compound serves as a key intermediate in the synthesis of potential therapeutic agents.
CAS Number | 2459439-16-6 |
Molecular Formula | C10H16ClN |
Purity | ≥95% |
IUPAC Name | (1S)-1-(4-ethylphenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C10H15N.ClH/c1-3-9-4-6-10(7-5-9)8(2)11;/h4-8H,3,11H2,1-2H3;1H/t8-;/m0./s1 |
InChIKey | VVCCRPRAEAGOHX-QRPNPIFTSA-N |
SMILES | CCC1=CC=C(C=C1)[C@H](C)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |