For research use only. Not for therapeutic Use.
(1S)-[1,1’-Binaphthalene]-2,2’-diol (Cat.No:R018270) is a chiral binaphthol compound often used as a chiral auxiliary in asymmetric synthesis. Its unique structure imparts chirality to various reactions, allowing for the selective formation of enantiomerically pure compounds. This compound is valuable in the preparation of optically active molecules for pharmaceutical and chemical applications.
CAS Number | 18531-99-2 |
Synonyms | (S)-BINOL |
Molecular Formula | C20H14O2 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
InChI | InChI=1S/C20H14O2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,21-22H |
InChIKey | PPTXVXKCQZKFBN-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |