Home
>
Reference Standards> [1S-(1R*,4E,9S*)]-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene
For research use only. Not for therapeutic Use.
[1S-(1R*,4E,9S*)]-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene(Cat No.:M066455) is a complex organic compound with a bicyclic structure. Its molecular formula is C15H24, and it is commonly referred to as α-cedrene. This sesquiterpene is found in essential oils of various plants, notably cedarwood oil, where it contributes to the characteristic woody aroma. α-Cedrene is utilized in fragrance and flavor industries as a natural scent enhancer and fixative. Additionally, it exhibits potential pharmacological properties, including anti-inflammatory and antimicrobial effects, making it a subject of interest in medicinal chemistry and natural product research.
CAS Number | 10579-93-8 |
Molecular Formula | C15H24 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1S,4E,9R)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-/m0/s1 |
InChIKey | NPNUFJAVOOONJE-IOMPXFEGSA-N |
SMILES | CC1=CCCC(=C)C2CC(C2CC1)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |