For research use only. Not for therapeutic Use.
(1S,2R)-2-(Methylamino)cyclopentan-1-ol(CAT: L012747) is a chiral compound with a cyclopentane ring where a hydroxyl group (-OH) is attached at the 1-position and a methylamino group (-NHCH3) is attached at the 2-position. The stereochemistry of the molecule is defined by the (1S,2R) configuration, indicating that the hydroxyl and methylamino groups are in specific spatial orientations relative to the cyclopentane ring. This compound can serve as a building block in the synthesis of bioactive molecules, particularly in medicinal chemistry for the development of drugs targeting neurological or cardiovascular conditions. The presence of both a hydroxyl and an amino group allows for various functional transformations, making it valuable in synthetic organic chemistry.
CAS Number | 135969-66-3 |
Molecular Formula | C6H13NO |
Purity | ≥95% |
IUPAC Name | (1S,2R)-2-(methylamino)cyclopentan-1-ol |
InChI | InChI=1S/C6H13NO/c1-7-5-3-2-4-6(5)8/h5-8H,2-4H2,1H3/t5-,6+/m1/s1 |
InChIKey | YAEYCYRQJINORB-RITPCOANSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |