For research use only. Not for therapeutic Use.
(1S,2R)-Bortezomib (Cat No.:R017651) is a chiral chemical compound used in medicine as an anticancer drug. It features a boronic acid group and is employed in the treatment of multiple myeloma and certain lymphomas. The specific stereoisomeric configuration, (1S,2R), plays a crucial role in its biological activity. By inhibiting proteasomes, cellular complexes responsible for degrading proteins, it interferes with cancer cell growth and survival. Bortezomib’s targeted mechanism makes it valuable in modern oncology, offering a therapeutic option for patients with hematological malignancies and contributing to the advancement of cancer treatment strategies.
CAS Number | 1132709-16-0 |
Synonyms | B-[(1S)-3-Methyl-1-[[(2R)-1-oxo-3-phenyl-2-[(2-pyrazinylcarbonyl)amino]propyl]amino]butyl]boronic Acid |
Molecular Formula | C19H25BN4O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(1S)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
InChI | InChI=1S/C19H25BN4O4/c1-13(2)10-17(20(27)28)24-18(25)15(11-14-6-4-3-5-7-14)23-19(26)16-12-21-8-9-22-16/h3-9,12-13,15,17,27-28H,10-11H2,1-2H3,(H,23,26)(H,24,25)/t15-,17-/m1/s1 |
InChIKey | GXJABQQUPOEUTA-NVXWUHKLSA-N |
SMILES | B(C(CC(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O |