Home
>
Chemical Reagents>Organic Building Blocks> (1S,2S)-2-(4-bromophenyl)cyclopropanecarboxylic acid
For research use only. Not for therapeutic Use.
(1S,2S)-2-(4-bromophenyl)cyclopropanecarboxylic acid(CAT: L000155) is a compound of significance in organic chemistry. Its action mechanism involves serving as a valuable intermediate for the synthesis of various organic compounds. This compound is essential in the development of complex organic molecules and is used as a building block for the creation of specialized chemical structures. It plays a crucial role in advancing organic synthesis and promoting innovation in the field of chemistry.
CAS Number | 1123620-89-2 |
Molecular Formula | C10H9BrO2 |
Purity | ≥95% |
IUPAC Name | (1S,2S)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid |
InChI | InChI=1S/C10H9BrO2/c11-7-3-1-6(2-4-7)8-5-9(8)10(12)13/h1-4,8-9H,5H2,(H,12,13)/t8-,9+/m1/s1 |
InChIKey | DPBUJVBXRABXRH-BDAKNGLRSA-N |