For research use only. Not for therapeutic Use.
2,2,5,5-Tetramethyl-1,3-cyclohexanedione (Cat No.:C001068) is a chemical compound with a cyclohexanedione core substituted with four methyl groups. It is a yellow crystalline solid and is used as a reagent in organic synthesis, particularly in the preparation of heterocyclic compounds and other complex molecules. This compound is of interest in chemical research due to its unique structure and reactivity.
| Catalog Number | C001068 |
| CAS Number | 702-50-1 |
| Synonyms | 2,2-Dimethyldimedone; Dimethyl-methone; NSC 116256; NSC 23390 |
| Molecular Formula | C₁₀H₁₆O₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C |
| IUPAC Name | 2,2,5,5-tetramethylcyclohexane-1,3-dione |
| InChI | InChI=1S/C10H16O2/c1-9(2)5-7(11)10(3,4)8(12)6-9/h5-6H2,1-4H3 |
| InChIKey | RMYOPLPHLGBSCY-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)(C)C)C |
| Reference | Wang, Y. et al.: Chemopshere, 90, 848 (2013); Hirahara, Y. et al.: Japan. J. Toxicol. Env. Health, 44, 451 (1998) |
