For research use only. Not for therapeutic Use.
2-(4-Hydroxyphenoxy-2,3,5,6-d4)-propanoic Acid (Cat No.:C000859) is a deuterium-labeled derivative of 2-(4-hydroxyphenyl)propanoic acid, a compound with potential pharmaceutical and chemical applications. The “d4” notation indicates that four hydrogen atoms in the molecule are replaced with deuterium, a stable isotope of hydrogen. This labeling allows for precise isotope tracking and tracing in various research fields, such as drug metabolism and pharmacokinetic studies. By using 2-(4-Hydroxyphenoxy-2,3,5,6-d4)-propanoic Acid, scientists can gain insights into the metabolic pathways and biological transformations of the parent compound, contributing to a deeper understanding of its potential therapeutic effects.
| Catalog Number | C000859 |
| CAS Number | 127893-32-7 |
| Synonyms | 2-(p-Hydroxyphenoxy)-propionic Acid-d4; 2-(4-Hydroxyphenoxy)propanoic Acid-d4; (±)-2-(4-Hydroxyphenoxy)propionic Acid-d4; 2-(p-Hydroxyphenoxy)propionic Acid-d4; Methyl (±)-2-(4-Hydroxyphenoxy)propanoate-d4; NSC 522955-d4; O-(4-Hydroxyphenyl)lactic Acid-d4; Radianskin PW LS 9918-d4; a-(p-Hydroxyphenoxy)propionic Acid-d4 |
| Molecular Formula | C₉H₆D₄O₄ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Pale Red to Light Red Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 2-(2,3,5,6-tetradeuterio-4-hydroxyphenoxy)propanoic acid |
| InChI | InChI=1S/C9H10O4/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6,10H,1H3,(H,11,12)/i2D,3D,4D,5D |
| InChIKey | AQIHDXGKQHFBNW-QFFDRWTDSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)O |
| Reference | Walker, K.A., et. al.: Biochem. J., 254, 307 (1988); Hajslova, J., et. al.: J. Chrom., 438, 55 (1988) |
