Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-[1-(3-Aminobenzoyl)piperidin-2-yl]ethan-1-ol
For research use only. Not for therapeutic Use.
2-[1-(3-Aminobenzoyl)piperidin-2-yl]ethan-1-ol(Cat No.:L007608), is a chemical compound comprising a piperidine ring with a 3-aminobenzoyl group attached at the 1-position and an ethyl group with a hydroxyl moiety at the 2-position. This specific molecular structure is significant in medicinal chemistry and drug discovery. Researchers study its interactions with biological targets, exploring its potential as a therapeutic agent. Its unique arrangement allows for diverse chemical modifications, enabling the development of compounds for biological testing.
CAS Number | 953744-04-2 |
Molecular Formula | C14H20N2O2 |
Purity | ≥95% |
IUPAC Name | (3-aminophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
InChI | InChI=1S/C14H20N2O2/c15-12-5-3-4-11(10-12)14(18)16-8-2-1-6-13(16)7-9-17/h3-5,10,13,17H,1-2,6-9,15H2 |
InChIKey | IRKAJYDEDQMVPD-UHFFFAOYSA-N |
SMILES | C1CCN(C(C1)CCO)C(=O)C2=CC(=CC=C2)N |