Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2-(1-Hydroxy-1,3-dihydro-2,1-benzoxaborol-3-yl)acetic acid
For research use only, not for therapeutic use.
2-(1-Hydroxy-1,3-dihydro-2,1-benzoxaborol-3-yl)acetic acid(Cat No.:L007903), with the chemical formula C9H9BO4. It is a compound featuring a benzoxazole ring substituted with a hydroxy group at the 1 position and an acetic acid group at the 2 position. Benzoxaborole derivatives are significant in medicinal chemistry research, often explored for their potential biological activities, especially in the development of antifungal and antibacterial agents. The presence of the hydroxy group and boron atom enhances its reactivity and binding affinity, making it valuable in drug discovery efforts.
Catalog Number | L007903 |
CAS Number | 19203-45-3 |
Molecular Formula | C9H9BO4 |
Purity | ≥95% |
IUPAC Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)acetic acid |
InChI | InChI=1S/C9H9BO4/c11-9(12)5-8-6-3-1-2-4-7(6)10(13)14-8/h1-4,8,13H,5H2,(H,11,12) |
InChIKey | ZJBJWSMUEYQHQD-UHFFFAOYSA-N |
SMILES | B1(C2=CC=CC=C2C(O1)CC(=O)O)O |