For research use only. Not for therapeutic Use.
2-[(1-Methyl-2-phenoxyethyl)amino]ethanol is an organic compound featuring an ethanol backbone with an amino group attached to a methyl-phenoxyethyl substituent. This compound is of interest in pharmaceutical and medicinal chemistry due to its potential bioactive properties. It can serve as an intermediate in the synthesis of various therapeutic agents, including beta-adrenergic blockers or other cardiovascular drugs. Its structure allows for interactions with biological receptors, making it a valuable building block in drug discovery and development processes.
Catalog Number | M067921 |
CAS Number | 103-39-9 |
Molecular Formula | C11H17NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(1-phenoxypropan-2-ylamino)ethanol |
InChI | InChI=1S/C11H17NO2/c1-10(12-7-8-13)9-14-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3 |
InChIKey | RANHEEPQMBBPKB-UHFFFAOYSA-N |
SMILES | CC(COC1=CC=CC=C1)NCCO |