Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 2-(1-Methylpiperidin-4-yl)acetic acid
For research use only. Not for therapeutic Use.
2-(1-Methylpiperidin-4-yl)acetic acid(Cat No.:L043939), is a piperidine derivative used in organic synthesis and pharmaceutical research. It features an acetic acid group attached to the piperidine ring at the 2-position and a methyl group at the 1-position. This versatile compound serves as a crucial intermediate in the synthesis of various organic molecules and pharmaceutical agents, making it valuable in drug development and medicinal chemistry research. Its unique structure allows for the introduction of specific functional groups, potentially enhancing biological activities or pharmacological properties.
CAS Number | 87647-06-1 |
Molecular Formula | C8H15NO2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2-(1-methylpiperidin-4-yl)acetic acid |
InChI | InChI=1S/C8H15NO2/c1-9-4-2-7(3-5-9)6-8(10)11/h7H,2-6H2,1H3,(H,10,11) |
InChIKey | KPQGGKCBIODRRY-UHFFFAOYSA-N |
SMILES | CN1CCC(CC1)CC(=O)O |