For research use only. Not for therapeutic Use.
2-([1,1′-Biphenyl]-2-yloxy)ethyl acrylate(Cat No.:M004193) is a specialized chemical compound used primarily in polymer chemistry. It features a biphenyl group, known for its stability and electronic properties, linked through an ether bond to an ethyl acrylate moiety. This structure is particularly notable for imparting the resultant polymers with enhanced optical and mechanical properties. The acrylate group allows for efficient polymerization, forming polymers that exhibit good adhesion, flexibility, and chemical resistance. These characteristics make it valuable for applications in coatings, adhesives, and sealants, especially where durability and performance are critical under various environmental conditions.
CAS Number | 91442-24-9 |
Synonyms | 2-Phenylphenoxyethyl acrylate;2-Propenoic acid 2-([1,1′-biphenyl]-2-yloxy)ethyl ester;OPPEA |
Molecular Formula | C17H16O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2-phenylphenoxy)ethyl prop-2-enoate |
InChI | InChI=1S/C17H16O3/c1-2-17(18)20-13-12-19-16-11-7-6-10-15(16)14-8-4-3-5-9-14/h2-11H,1,12-13H2 |
InChIKey | VAZQKPWSBFZARZ-UHFFFAOYSA-N |
SMILES | C=CC(=O)OCCOC1=CC=CC=C1C2=CC=CC=C2 |