Home
>
Chemical Reagents>Organometallic Reagents> 2-([1,1'-Biphenyl]-4-yl)-5,5-dimethyl-1,3,2-dioxaborinane
For research use only. Not for therapeutic Use.
2-([1,1′-Biphenyl]-4-yl)-5,5-dimethyl-1,3,2-dioxaborinane(CAT: L000407) is a significant compound in the field of material chemistry. This boron-containing organic molecule is a crucial building block for the synthesis of advanced organic materials and polymers. Its boron moiety plays a pivotal role in enhancing the thermal and electronic properties of these materials, making it indispensable in the development of high-performance materials.
CAS Number | 5123-05-7 |
Molecular Formula | C17H19BO2 |
Purity | ≥95% |
IUPAC Name | 5,5-dimethyl-2-(4-phenylphenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C17H19BO2/c1-17(2)12-19-18(20-13-17)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3 |
InChIKey | YDDJRASPLUZILE-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |