Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-{1,3-dimethyl-2,4-dioxo-1H,2H,3H,4H,7H-pyrrolo[2,3-d]pyrimidin-7-yl}
For research use only. Not for therapeutic Use.
2-{1,3-dimethyl-2,4-dioxo-1H,2H,3H,4H,7H-pyrrolo[2,3-d]pyrimidin-7-yl}(Cat No.:L007191), is a complex chemical structure. It features a pyrrolo[2,3-d]pyrimidin core—a bicyclic heterocyclic system—substituted with two oxo groups at the 2nd and 4th positions and a dimethylamino group at the 7th position. Although specific details about its applications and biological activities are not provided, this compound likely holds significance in medicinal chemistry and drug discovery research. Its intricate structure suggests potential interactions with biological targets, making it a subject of interest for researchers in the field. The compound’s unique architecture might be utilized for creating novel bioactive molecules, contributing to advancements in therapeutic research.
CAS Number | 950259-70-8 |
Molecular Formula | C10H11N3O4 |
Purity | ≥95% |
IUPAC Name | 2-(1,3-dimethyl-2,4-dioxopyrrolo[2,3-d]pyrimidin-7-yl)acetic acid |
InChI | InChI=1S/C10H11N3O4/c1-11-8-6(9(16)12(2)10(11)17)3-4-13(8)5-7(14)15/h3-4H,5H2,1-2H3,(H,14,15) |
InChIKey | LLKCIODTVWGFEW-UHFFFAOYSA-N |
SMILES | CN1C2=C(C=CN2CC(=O)O)C(=O)N(C1=O)C |