For research use only. Not for therapeutic Use.
2-(1,3-Dioxoisoindolin-2-yl)pentanedioic acid(Cat No.:I042998)is a chemical compound featuring a dioxoisoindoline group attached to a pentanedioic acid backbone. The isoindoline structure is known for its aromaticity and stability, while the pentanedioic acid component introduces a functional group that may facilitate interactions with biological targets. This compound has potential applications in medicinal chemistry, particularly in the development of bioactive molecules that can modulate enzymatic or receptor functions. Its unique structure makes it a promising candidate for research in areas such as cancer therapy, neurodegenerative diseases, and other conditions requiring targeted therapeutic strategies.
CAS Number | 6349-98-0 |
Synonyms | 2-(1,3-dioxoisoindol-2-yl)pentanedioic acid |
Molecular Formula | C13H11NO6 |
Purity | ≥95% |
IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)pentanedioic acid |
InChI | InChI=1S/C13H11NO6/c15-10(16)6-5-9(13(19)20)14-11(17)7-3-1-2-4-8(7)12(14)18/h1-4,9H,5-6H2,(H,15,16)(H,19,20) |
InChIKey | FEFFSKLJNYRHQN-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C(CCC(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |