Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(1H-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid
For research use only. Not for therapeutic Use.
2-(1H-1,2,4-triazol-1-yl)pyridine-4-carboxylic acid(Cat No.:L007298), is a chemical compound with the molecular formula C8H6N4O2. This compound belongs to the class of organic compounds known as pyridine carboxylic acids, which are compounds containing a pyridine ring bearing a carboxyl group. The structure of this specific compound includes a pyridine ring substituted at the 2nd and 4th positions with a 1,2,4-triazole group and a carboxylic acid group, respectively. Researchers might use this compound in chemical synthesis, medicinal chemistry, or other scientific applications due to its specific structure and potential biological activity.
CAS Number | 263270-38-8 |
Molecular Formula | C8H6N4O2 |
Purity | ≥95% |
IUPAC Name | 2-(1,2,4-triazol-1-yl)pyridine-4-carboxylic acid |
InChI | InChI=1S/C8H6N4O2/c13-8(14)6-1-2-10-7(3-6)12-5-9-4-11-12/h1-5H,(H,13,14) |
InChIKey | NTTPOXNTFBISRL-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=C1C(=O)O)N2C=NC=N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |