For research use only. Not for therapeutic Use.
2-(1H-1,2,4-triazol-5-yl)pyrazine is a heterocyclic compound featuring a pyrazine ring substituted at the 2-position with a 1H-1,2,4-triazole group. This compound is significant in medicinal chemistry due to its potential biological activities, including antimicrobial and antifungal properties. The triazole moiety enhances its reactivity and solubility, allowing for diverse chemical transformations. Its unique structure makes it a valuable scaffold for the development of novel therapeutic agents and in the synthesis of various bioactive compounds in drug discovery.
Catalog Number | L019455 |
CAS Number | 130612-31-6 |
Molecular Formula | C6H5N5 |
Purity | ≥95% |
IUPAC Name | 2-(1H-1,2,4-triazol-5-yl)pyrazine |
InChI | InChI=1S/C6H5N5/c1-2-8-5(3-7-1)6-9-4-10-11-6/h1-4H,(H,9,10,11) |
InChIKey | UVERQPQFEHVFEB-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=N1)C2=NC=NN2 |