For research use only. Not for therapeutic Use.
2-(1H-Inden-3-yl)ethan-1-amine hydrochloride(Cat No.:L007355), is a chemical compound used in the field of medicinal chemistry and drug discovery. This compound, typically found in its hydrochloride salt form, is utilized in research settings to explore its potential biological activities. Scientists often study its interactions with biological targets, aiming to understand its pharmacological effects and assess its suitability as a drug candidate.
CAS Number | 1021871-55-5 |
Molecular Formula | C11H14ClN |
Purity | ≥95% |
IUPAC Name | 2-(3H-inden-1-yl)ethanamine;hydrochloride |
InChI | InChI=1S/C11H13N.ClH/c12-8-7-10-6-5-9-3-1-2-4-11(9)10;/h1-4,6H,5,7-8,12H2;1H |
InChIKey | QAMRTZJFPSJMLC-UHFFFAOYSA-N |
SMILES | C1C=C(C2=CC=CC=C21)CCN.Cl |