For research use only. Not for therapeutic Use.
2-(1H-Indol-3-ylmethylidene)propanedinitrile is an organic compound featuring an indole ring linked to a propanedinitrile group, widely used in pharmaceutical and chemical research. Its structure makes it a valuable intermediate in synthesizing bioactive molecules, particularly in the development of drugs targeting cancer and other diseases. This compound’s reactivity and versatility allow for further chemical modifications, making it useful in medicinal chemistry. It plays a key role in creating novel therapeutic agents and advancing research in drug discovery and molecular biology.
CAS Number | 75629-62-8 |
Molecular Formula | C12H7N3 |
Purity | ≥95% |
IUPAC Name | 2-(1H-indol-3-ylmethylidene)propanedinitrile |
InChI | InChI=1S/C12H7N3/c13-6-9(7-14)5-10-8-15-12-4-2-1-3-11(10)12/h1-5,8,15H |
InChIKey | KCGMQWDGOQQAGN-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)C=C(C#N)C#N |