Home
>
Inhibitors/Agonists>Apoptosis> 2-[2-(3,4-Dihydroxy-phenyl)-vinyl]-3-(2-methoxy-phenyl)-3H-quinazolin-4-one
For research use only. Not for therapeutic Use.
2-[2-(3,4-Dihydroxy-phenyl)-vinyl]-3-(2-methoxy-phenyl)-3H-quinazolin-4-one(CAT: L000716) is a quinazolinone derivative. It exhibits inhibitory action by targeting specific enzymatic pathways involved in cellular processes. This compound holds potential in pharmaceutical research due to its interactions with key biological molecules, making it a promising candidate for drug development. Furthermore, its versatile structure allows applications in organic chemistry synthesis, contributing to the advancement of novel methodologies.
CAS Number | 2041072-41-5 |
Molecular Formula | C23H18N2O4 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methoxyphenyl)quinazolin-4-one |
InChI | InChI=1S/C23H18N2O4/c1-29-21-9-5-4-8-18(21)25-22(13-11-15-10-12-19(26)20(27)14-15)24-17-7-3-2-6-16(17)23(25)28/h2-14,26-27H,1H3/b13-11+ |
InChIKey | OTKDKQJFWIGZLU-ACCUITESSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |