2-[2-(4-methyl-1,3-thiazol-5-yl)-1H-1,3-benzodiazol-1-yl]acetic acid

• CAT Number: L007251
• CAS Number: 1094744-10-1
• Molecular Formula: C13H11N3O2S
• Molecular Weight: 273.31
• Purity: ≥95%
• IUPAC Name: 2-[2-(4-methyl-1,3-thiazol-5-yl)benzimidazol-1-yl]acetic acid
• InChI: InChI=1S/C13H11N3O2S/c1-8-12(19-7-14-8)13-15-9-4-2-3-5-10(9)16(13)6-11(17)18/h2-5,7H,6H2,1H3,(H,17,18)
• InChIKey: WIRBKKOIWQAZNX-UHFFFAOYSA-N
• SMILES: CC1=C(SC=N1)C2=NC3=CC=CC=C3N2CC(=O)O

2-[2-(4-methyl-1,3-thiazol-5-yl)-1H-1,3-benzodiazol-1-yl]acetic acid（Cat No.:L007251）, is a chemical compound used in medicinal chemistry research and drug discovery. This compound contains a thiazole and a benzodiazepine moiety, making it a valuable scaffold for designing potential pharmaceutical agents. Researchers employ it in the synthesis of small molecules for biological testing, targeting specific receptors or enzymes in various diseases. Its unique structural features make it a crucial intermediate for the development of novel drugs, contributing significantly to advancements in the field of medicinal chemistry and the discovery of new therapeutic agents.