Home
>
Chemical Reagents>Organometallic Reagents> 2-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyridine
For research use only. Not for therapeutic Use.
2-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyridine (Cat.No:L003488) is a crucial compound in materials science. Its unique structure incorporates a boron-containing dioxaborolane moiety, rendering it valuable in Suzuki-Miyaura cross-coupling reactions. This compound serves as a pivotal building block for the synthesis of specialized materials and pharmaceuticals, exemplifying its significance in contemporary chemical research
Catalog Number | L003488 |
CAS Number | 1349171-28-3 |
Molecular Formula | C17H20BNO2 |
Purity | ≥95% |
IUPAC Name | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
InChI | InChI=1S/C17H20BNO2/c1-16(2)17(3,4)21-18(20-16)14-10-6-5-9-13(14)15-11-7-8-12-19-15/h5-12H,1-4H3 |
InChIKey | SQOVXXHEUULZCK-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C3=CC=CC=N3 |