For research use only. Not for therapeutic Use.
2- ( 2-Aminobenzoyl ) pyridine (Cat. No: R019993) is a heterocyclic building block that can be used to synthesize intermediates of various quinoline derivatives, mainly for laboratory research and development and chemical and pharmaceutical synthesis.
CAS Number | 42471-56-7 |
Synonyms | (2-Aminophenyl)-2-pyridinylmethanone; (2-Aminophenyl)pyridin-2-ylmethanone; 2-Aminophenyl 2-pyridyl Ketone; |
Molecular Formula | C12H10N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2-aminophenyl)-pyridin-2-ylmethanone |
InChI | InChI=1S/C12H10N2O/c13-10-6-2-1-5-9(10)12(15)11-7-3-4-8-14-11/h1-8H,13H2 |
InChIKey | WEWXXYDHYCDEKY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=N2)N |