Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(2-Aminoethyl)-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one
For research use only. Not for therapeutic Use.
2-(2-Aminoethyl)-3′,6′-bis(diethylamino)spiro[isoindoline-1,9′-xanthen]-3-one is a complex organic compound featuring a spiro structure that combines an isoindoline core with a xanthenone moiety. The presence of two diethylamino groups and an aminoethyl substituent enhances its potential for various chemical interactions, making it interesting for applications in medicinal chemistry and organic synthesis. This compound may exhibit unique optical or electronic properties, positioning it as a candidate for developing dyes, fluorescent materials, or pharmaceutical agents in research and development.
CAS Number | 950846-89-6 |
Molecular Formula | C30H36N4O2 |
Purity | ≥95% |
IUPAC Name | 2-(2-aminoethyl)-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
InChI | InChI=1S/C30H36N4O2/c1-5-32(6-2)21-13-15-25-27(19-21)36-28-20-22(33(7-3)8-4)14-16-26(28)30(25)24-12-10-9-11-23(24)29(35)34(30)18-17-31/h9-16,19-20H,5-8,17-18,31H2,1-4H3 |
InChIKey | HSABBFJVLMEXKT-UHFFFAOYSA-N |
SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3CCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |