For research use only. Not for therapeutic Use.
2-(2-(Benzyloxy)-4-fluorophenyl)acetonitrile(CAT: L010501) is a high-purity aromatic compound widely utilized in pharmaceutical and chemical research. Featuring a fluorinated phenyl core with a benzyloxy group at the 2-position and an acetonitrile functional group, this compound serves as a versatile intermediate for synthesizing complex organic molecules, including bioactive compounds and potential drug candidates. Its unique structure and reactivity make it particularly valuable for applications in medicinal chemistry, such as the development of enzyme inhibitors and receptor modulators. 2-(2-(Benzyloxy)-4-fluorophenyl)acetonitrile ensures reliable performance and consistency, supporting innovative research in drug discovery and advanced synthetic methodologies.
CAS Number | 1824265-83-9 |
Molecular Formula | C15H12FNO |
Purity | ≥95% |
IUPAC Name | 2-(4-fluoro-2-phenylmethoxyphenyl)acetonitrile |
InChI | InChI=1S/C15H12FNO/c16-14-7-6-13(8-9-17)15(10-14)18-11-12-4-2-1-3-5-12/h1-7,10H,8,11H2 |
InChIKey | MKEYIBZSBFCDFG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |