For research use only. Not for therapeutic Use.
2-(2-Bromo-3-chloro-4-fluorophenyl)acetic acid(CAT: L000064) plays a crucial role in pharmaceutical research. It functions as a key building block for synthesizing novel pharmaceutical compounds, targeting specific disease pathways in medicinal chemistry. Its unique structure allows for the development of potential drugs with applications in various therapeutic areas, including oncology and anti-inflammatory drugs.
CAS Number | 2384318-64-1 |
Molecular Formula | C8H5BrClFO2 |
Purity | ≥95% |
IUPAC Name | 2-(2-bromo-3-chloro-4-fluorophenyl)acetic acid |
InChI | InChI=1S/C8H5BrClFO2/c9-7-4(3-6(12)13)1-2-5(11)8(7)10/h1-2H,3H2,(H,12,13) |
InChIKey | LHVRXJYVOYIDBF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |