For research use only. Not for therapeutic Use.
2-(2-(Bromomethyl)phenyl)acetonitrile(Cat No.:L017248)is an organic compound used as an intermediate in pharmaceutical and chemical synthesis. This molecule features a phenyl ring substituted with a bromomethyl group and an acetonitrile group, making it a versatile building block for creating complex molecules. It is particularly valuable in the development of bioactive compounds, including potential drug candidates and agrochemicals. The bromomethyl group provides a reactive site for further chemical transformations, making it useful in advanced research focused on medicinal chemistry and material science.
CAS Number | 73217-11-5 |
Molecular Formula | C9H8BrN |
Purity | ≥95% |
IUPAC Name | 2-[2-(bromomethyl)phenyl]acetonitrile |
InChI | InChI=1S/C9H8BrN/c10-7-9-4-2-1-3-8(9)5-6-11/h1-4H,5,7H2 |
InChIKey | KBAPOYSPGUUBJQ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CC#N)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |