For research use only. Not for therapeutic Use.
2-(2-Chloro-4-fluorophenyl) propane-2-amine hydrochloride(Cat No.:L007489), is a chemical entity with notable pharmacological significance. Its molecular structure comprises a propan-2-amine backbone with a chloro and fluorophenyl substituent. This compound, often studied in the context of medicinal chemistry and pharmacology, exhibits intriguing biological activities. Researchers investigate its potential therapeutic applications, aiming to harness its unique properties for drug development.
CAS Number | 1306604-78-3 |
Molecular Formula | C9H12Cl2FN |
Purity | ≥95% |
IUPAC Name | 2-(2-chloro-4-fluorophenyl)propan-2-amine;hydrochloride |
InChI | InChI=1S/C9H11ClFN.ClH/c1-9(2,12)7-4-3-6(11)5-8(7)10;/h3-5H,12H2,1-2H3;1H |
InChIKey | CQNBHJGHRQJJJX-UHFFFAOYSA-N |
SMILES | CC(C)(C1=C(C=C(C=C1)F)Cl)N.Cl |