Home
>
Chemical Reagents>Organometallic Reagents> 2-(2-Chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
2-(2-Chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (Cat.No:L003630) is a pivotal chemical compound with wide-ranging applications in materials science. Its unique boron-containing structure lends itself to various synthetic transformations, particularly in the preparation of specialized materials and pharmaceuticals. This compound’s versatility and reactivity highlight its significance in contemporary chemical research, playing a crucial role in the development of innovative materials for diverse industries, including pharmaceuticals and electronics.
CAS Number | 1144097-12-0 |
Molecular Formula | C13H18BClO2 |
Purity | ≥95% |
IUPAC Name | 2-(2-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C13H18BClO2/c1-9-6-7-10(11(15)8-9)14-16-12(2,3)13(4,5)17-14/h6-8H,1-5H3 |
InChIKey | JQGJYYVZYCVUFV-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |