For research use only. Not for therapeutic Use.
2-(2-Chlorobenzylidene)malononitrile(Cat No.:M016569)is a potent chemical compound commonly used as a riot control agent, known as CS gas or tear gas. It is highly effective in crowd control due to its strong irritant effects on the eyes, skin, and respiratory system, causing intense tearing, pain, and discomfort. This compound works quickly to incapacitate individuals temporarily without causing permanent harm. Its applications extend to law enforcement and military settings for managing civil disturbances. Despite its effectiveness, safety precautions are essential to minimize exposure risks and potential health impacts.
CAS Number | 2698-41-1 |
Synonyms | ((2-chlorophenyl)methylene)-propanedinitril;((2-chloro-phenyl)methylene)propanenitrile;(o-Chlorobenzal)malononitrile;(o-Chlorobenzylidene)malonitrile;(o-chlorobenzylidene)-malononitril;(o-Chlorobenzylidene)malononitrile;[(2-chlorophenyl)methylene]-pr |
Molecular Formula | C10H5ClN2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[(2-chlorophenyl)methylidene]propanedinitrile |
InChI | InChI=1S/C10H5ClN2/c11-10-4-2-1-3-9(10)5-8(6-12)7-13/h1-5H |
InChIKey | JJNZXLAFIPKXIG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C=C(C#N)C#N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |