For research use only. Not for therapeutic Use.
2-(2-Chloroethyl)-5-ethylpyridine (Cat.No:L003493) is a notable chemical compound with applications in pharmaceutical and agrochemical industries. Its structure features a chloroethyl group and an ethylpyridine moiety, granting it significant reactivity. This compound serves as a crucial intermediate in the synthesis of various biologically active compounds, showcasing its importance in the development of pharmaceutical agents and agrochemicals
Catalog Number | L003493 |
CAS Number | 69603-36-7 |
Molecular Formula | C9H12ClN |
Purity | ≥95% |
IUPAC Name | 2-(2-chloroethyl)-5-ethylpyridine |
InChI | InChI=1S/C9H12ClN/c1-2-8-3-4-9(5-6-10)11-7-8/h3-4,7H,2,5-6H2,1H3 |
InChIKey | JLDJBDXBFWGQPC-UHFFFAOYSA-N |
SMILES | CCC1=CN=C(C=C1)CCCl |