For research use only. Not for therapeutic Use.
2-(2-Chlorophenyl)-1,3,2-dioxaborinane(CAT: L000476) is a compound of importance in organic chemistry, particularly as a versatile building block in the synthesis of various organic molecules. This compound serves as a valuable intermediate with applications in different fields, including pharmaceutical, agrochemical, and material chemistry. Its unique structure and reactivity make it a crucial tool for chemists and researchers, enabling the creation of a wide range of organic compounds for diverse purposes.
CAS Number | 172732-59-1 |
Molecular Formula | C9H10BClO2 |
Purity | ≥95% |
IUPAC Name | 2-(2-chlorophenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C9H10BClO2/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5H,3,6-7H2 |
InChIKey | NANBZMBMVCMGJL-UHFFFAOYSA-N |