For research use only. Not for therapeutic Use.
2-(2-Chlorophenyl)-N-(1,3-thiazol-2-yl)acetamide(CAT: L003216) is a high-purity compound widely utilized in pharmaceutical and organic synthesis research. Featuring a chlorophenyl group and a thiazolyl-substituted acetamide structure, this versatile molecule serves as a key intermediate in the development of bioactive compounds and functional materials. Its unique framework makes it valuable in medicinal chemistry for exploring novel therapeutic candidates and chemical pathways. With excellent stability and precise formulation, 2-(2-Chlorophenyl)-N-(1,3-thiazol-2-yl)acetamide ensures reliable and reproducible results, making it a dependable choice for researchers advancing innovation in drug discovery and synthetic chemistry.
CAS Number | 796115-75-8 |
Molecular Formula | C11H9ClN2OS |
Purity | ≥95% |
IUPAC Name | 2-(2-chlorophenyl)-N-(1,3-thiazol-2-yl)acetamide |
InChI | InChI=1S/C11H9ClN2OS/c12-9-4-2-1-3-8(9)7-10(15)14-11-13-5-6-16-11/h1-6H,7H2,(H,13,14,15) |
InChIKey | FLITWEQVHZUSRH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CC(=O)NC2=NC=CS2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |