For research use only. Not for therapeutic Use.
2-(2-[Ethyl(methyl)amino]ethoxy)ethan-1-ol(Cat No.:L007342), is a chemical compound utilized in various industrial and research applications. This compound contains a hydroxyl group, making it suitable for reactions involving alcohols. The presence of an amino group and an ethoxy group adds to its versatility, allowing it to participate in numerous organic synthesis processes. Researchers and chemists employ this compound as a reagent in the development of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure contributes to its significance as a building block in the synthesis of complex molecules for diverse applications.
CAS Number | 123119-86-8 |
Molecular Formula | C7H17NO2 |
Purity | ≥95% |
IUPAC Name | 2-[2-[ethyl(methyl)amino]ethoxy]ethanol |
InChI | InChI=1S/C7H17NO2/c1-3-8(2)4-6-10-7-5-9/h9H,3-7H2,1-2H3 |
InChIKey | RJASLUHIBPFIPK-UHFFFAOYSA-N |
SMILES | CCN(C)CCOCCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |