For research use only. Not for therapeutic Use.
2-(2-Ethylphenyl)acetonitrile(Cat No.:L006735), is a chemical compound with the molecular formula C10H11N. It consists of an acetonitrile group (-CN) attached to a phenyl ring, where the phenyl ring is further substituted with an ethyl group. This compound is used as a building block in the synthesis of various organic compounds. Its versatile structure makes it valuable in medicinal chemistry and pharmaceutical research for creating new molecules with potential biological activities. Researchers utilize it as a key intermediate in the development of pharmaceuticals and other specialty chemicals due to its ability to participate in diverse chemical reactions.
CAS Number | 74533-20-3 |
Molecular Formula | C10H11N |
Purity | ≥95% |
IUPAC Name | 2-(2-ethylphenyl)acetonitrile |
InChI | InChI=1S/C10H11N/c1-2-9-5-3-4-6-10(9)7-8-11/h3-6H,2,7H2,1H3 |
InChIKey | LLLAUEJCYCBLPM-UHFFFAOYSA-N |
SMILES | CCC1=CC=CC=C1CC#N |