For research use only. Not for therapeutic Use.
2-(2-Fluorophenyl)-2-methylpropanoic acid(CAT: L035029) is a high-purity fluorinated aromatic carboxylic acid widely utilized in pharmaceutical research and organic synthesis. Featuring a 2-fluorophenyl group and a methyl-substituted propanoic acid core, it serves as a critical intermediate for developing bioactive molecules, small-molecule inhibitors, and pharmaceutical candidates. The fluorine substitution enhances metabolic stability, lipophilicity, and bioavailability, making it particularly valuable in medicinal chemistry for optimizing drug-like properties. 2-(2-Fluorophenyl)-2-methylpropanoic acid supports precision synthesis and innovative research in both academic and industrial applications, offering reliability and versatility for advanced compound development.
CAS Number | 870849-49-3 |
Molecular Formula | C10H11FO2 |
Purity | ≥95% |
IUPAC Name | 2-(2-fluorophenyl)-2-methylpropanoic acid |
InChI | InChI=1S/C10H11FO2/c1-10(2,9(12)13)7-5-3-4-6-8(7)11/h3-6H,1-2H3,(H,12,13) |
InChIKey | DCCIKELFJWXVFL-UHFFFAOYSA-N |
SMILES | CC(C)(C1=CC=CC=C1F)C(=O)O |