For research use only. Not for therapeutic Use.
2-(2-formylphenoxy)-N, N-dimethylacetamide(Cat No.:L007562), is a chemical compound with a distinct molecular structure. It consists of a formyl group attached to a phenyl ring, connected to a dimethylacetamide moiety. This compound finds applications in various fields, including organic synthesis and medicinal chemistry. Its unique structure makes it valuable for designing new molecules with specific properties. Researchers use it as a building block in the synthesis of pharmaceuticals and agrochemicals. Its versatility in reactions and compatibility with diverse chemical processes make it a significant component in the development of novel compounds for industrial and research purposes.
CAS Number | 124490-59-1 |
Molecular Formula | C11H13NO3 |
Purity | ≥95% |
IUPAC Name | 2-(2-formylphenoxy)-N,N-dimethylacetamide |
InChI | InChI=1S/C11H13NO3/c1-12(2)11(14)8-15-10-6-4-3-5-9(10)7-13/h3-7H,8H2,1-2H3 |
InChIKey | DGEPAQUIZIHKQL-UHFFFAOYSA-N |
SMILES | CN(C)C(=O)COC1=CC=CC=C1C=O |