For research use only. Not for therapeutic Use.
2-(2-Heptadec-1-enyl-2-imidazolin-1-yl)ethanol(Cat No.:M080298) is a synthetic compound characterized by a long-chain heptadecene substituent linked to an imidazoline ring. The chemical structure includes an ethanol group attached to the imidazoline, enhancing its solubility and interaction with biological molecules. This compound is typically used in the chemical industry as a surfactant or emulsifying agent due to its amphiphilic nature, allowing it to reduce surface tension between different media. Its properties make it useful in formulations of cosmetics, pharmaceuticals, and cleaning products, where stabilization of mixtures is crucial.
CAS Number | 17158-54-2 |
Molecular Formula | C22H42N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[2-[(E)-heptadec-1-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
InChI | InChI=1S/C22H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25/h16-17,25H,2-15,18-21H2,1H3/b17-16+ |
InChIKey | BNGLZYYFFZFNDJ-WUKNDPDISA-N |
SMILES | CCCCCCCCCCCCCCCC=CC1=NCCN1CCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |