For research use only. Not for therapeutic Use.
2-(2-Hydroxyethyl)-p-phenylenediamine sulfate(Cat No.:M005238)is a chemical compound. It consists of a p-phenylenediamine backbone substituted with a hydroxyethyl group, making it a crucial intermediate in dye manufacture, particularly in hair coloring products. The sulfate salt form enhances its solubility and handling. This compound is noted for its ability to form various shades when oxidized, providing a broad spectrum of colors. Its reactive amino groups facilitate easy binding with hair keratin, leading to lasting color. It’s also used in textile dyeing and ink production due to its stable color properties.
CAS Number | 93841-25-9 |
Synonyms | hydroxyethyl-p-phenylenediamine sulphate;2-(2-HYDROXY)ETHYL-P-PHENYLENE DIAMINO SULFATE;3-(2-hydroxyethyl)-p-phenylenediammonium sulphate;HYDROXYETHYL-p-PHENYLENEDIAMINE SULFATE;2,5-Diaminophenylethanolsulfate;Hydroxyethyl-p-phenylenediaminesulfateph |
Molecular Formula | C8H14N2O5S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2,5-diaminophenyl)ethanol;sulfuric acid |
InChI | InChI=1S/C8H12N2O.H2O4S/c9-7-1-2-8(10)6(5-7)3-4-11;1-5(2,3)4/h1-2,5,11H,3-4,9-10H2;(H2,1,2,3,4) |
InChIKey | VBSLNFWECRRALP-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N)CCO)N.OS(=O)(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |