2-(2-Hydroxyphenyl)-2-oxazoline(Cat No.:L002433)is a heterocyclic compound featuring an oxazoline ring and a hydroxyphenyl group. This compound is widely used in organic synthesis and polymer chemistry, particularly for the development of ligands, catalysts, and advanced materials. The hydroxyl group on the phenyl ring allows for further functionalization, while the oxazoline ring is known for its stability and reactivity in various chemical reactions. Its unique structure makes it valuable for creating complex molecules, especially in the synthesis of pharmaceuticals and specialty polymers, contributing to advancements in material science and drug discovery.
Catalog Number | L002433 |
CAS Number | 20237-92-7 |
Molecular Formula | C9H9NO2 |
Purity | 95% |
IUPAC Name | 2-(4,5-dihydro-1,3-oxazol-2-yl)phenol |
InChI | InChI=1S/C9H9NO2/c11-8-4-2-1-3-7(8)9-10-5-6-12-9/h1-4,11H,5-6H2 |
InChIKey | FETLPNKZRXDWLT-UHFFFAOYSA-N |
SMILES | C1COC(=N1)C2=CC=CC=C2O |