For research use only. Not for therapeutic Use.
2-(2-Hydroxyphenyl)benzothiazole(Cat No.:L045248)is a heterocyclic compound widely used in chemical and pharmaceutical research. Featuring a benzothiazole core linked to a hydroxyphenyl group, this molecule exhibits unique photophysical properties, making it valuable in developing fluorescent probes and sensors. It is also used as a key intermediate in synthesizing bioactive molecules, including potential therapeutic agents. Its ability to form stable complexes with metals further enhances its application in materials science and catalysis. 2-(2-Hydroxyphenyl)benzothiazole is essential for researchers focused on innovative applications in synthetic and medicinal chemistry.
CAS Number | 3411-95-8 |
Molecular Formula | C13H9NOS |
Purity | ≥95% |
IUPAC Name | 2-(1,3-benzothiazol-2-yl)phenol |
InChI | InChI=1S/C13H9NOS/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,15H |
InChIKey | MVVGSPCXHRFDDR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=NC3=CC=CC=C3S2)O |