For research use only. Not for therapeutic Use.
2-[(2-Methoxyphenyl)methoxy]acetic acid(Cat No.:L007462), is a chemical compound with versatile applications in the field of organic synthesis and medicinal chemistry. This compound consists of a carboxylic acid group attached to a methoxyphenylmethoxy moiety. Researchers use it as a valuable building block in the synthesis of various biologically active compounds. Its unique structure allows it to participate in diverse chemical reactions, making it a crucial component in the development of pharmaceuticals and agrochemicals.
CAS Number | 180044-49-9 |
Molecular Formula | C10H12O4 |
Purity | ≥95% |
IUPAC Name | 2-[(2-methoxyphenyl)methoxy]acetic acid |
InChI | InChI=1S/C10H12O4/c1-13-9-5-3-2-4-8(9)6-14-7-10(11)12/h2-5H,6-7H2,1H3,(H,11,12) |
InChIKey | FRGJPVWNZSVXRA-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1COCC(=O)O |