For research use only. Not for therapeutic Use.
2-(2-methyl-1H-imidazol-1-yl)pyridine-4-carbonitrile(Cat No.:L007564), is a chemical compound with a unique structure. It contains a pyridine ring coupled with a carbonitrile group and a methylated imidazole moiety. This compound is of interest in medicinal chemistry and pharmaceutical research due to its potential biological activities. Scientists often study its interactions with biological targets, exploring its role in drug discovery processes. Its specialized structure allows for diverse chemical reactions, making it a valuable intermediate in the synthesis of complex molecules.
Catalog Number | L007564 |
CAS Number | 1016841-67-0 |
Molecular Formula | C10H8N4 |
Purity | ≥95% |
IUPAC Name | 2-(2-methylimidazol-1-yl)pyridine-4-carbonitrile |
InChI | InChI=1S/C10H8N4/c1-8-12-4-5-14(8)10-6-9(7-11)2-3-13-10/h2-6H,1H3 |
InChIKey | CZUAYUIAZRJRPC-UHFFFAOYSA-N |
SMILES | CC1=NC=CN1C2=NC=CC(=C2)C#N |