For research use only. Not for therapeutic Use.
2-(2-Methylbenzamido)acetic Acid-d7 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of 2-(2-Methylbenzamido)acetic Acid is crucial for studies involving metabolic pathway analysis, drug metabolism, and pharmacokinetic profiling. Featuring seven deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for biochemistry research and drug development, 2-(2-Methylbenzamido)acetic Acid-d7 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 1216430-90-8 |
Molecular Formula | C10H4D7NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2-[[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)benzoyl]amino]acetic acid |
InChI | InChI=1S/C10H11NO3/c1-7-4-2-3-5-8(7)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)(H,12,13)/i1D3,2D,3D,4D,5D |
InChIKey | YOEBAVRJHRCKRE-AAYPNNLASA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)NCC(=O)O)C([2H])([2H])[2H])[2H])[2H] |